C23H27N3O3S — CID 153301778
6-[1-[3-(benzenesulfonylmethyl)oxetan-3-yl]piperidin-4-yl]-5-methyl-1H-indazole (PubChem CID 153301778) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 6-[1-[3-(benzenesulfonylmethyl)oxetan-3-yl]piperidin-4-yl]-5-methyl-1H-indazole.
| Compound Name | 6-[1-[3-(benzenesulfonylmethyl)oxetan-3-yl]piperidin-4-yl]-5-methyl-1H-indazole |
|---|---|
| PubChem CID | 153301778 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 6-[1-[3-(benzenesulfonylmethyl)oxetan-3-yl]piperidin-4-yl]-5-methyl-1H-indazole |
| SMILES | Cc1cc2cn[nH]c2cc1C1CCN(C2(CS(=O)(=O)c3ccccc3)COC2)CC1 |
| InChI | InChI=1S/C23H27N3O3S/c1-17-11-19-13-24-25-22(19)12-21(17)18-7-9-26(10-8-18)23(14-29-15-23)16-30(27,28)20-5-3-2-4-6-20/h2-6,11-13,18H,7-10,14-16H2,1H3,(H,24,25) |
| InChIKey | OQSMKAJWGZHOPZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |