C20H25N5 — CID 171698004
5-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]-6-methyl-1H-indazole (PubChem CID 171698004) has the molecular formula C20H25N5 and a molecular weight of 335.46 g/mol. Its IUPAC name is 5-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]-6-methyl-1H-indazole.
| Compound Name | 5-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]-6-methyl-1H-indazole |
|---|---|
| PubChem CID | 171698004 |
| Molecular Formula | C20H25N5 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 5-[5-[(4-ethylpiperazin-1-yl)methyl]-2-pyridinyl]-6-methyl-1H-indazole |
| SMILES | CCN1CCN(Cc2ccc(-c3cc4cn[nH]c4cc3C)nc2)CC1 |
| InChI | InChI=1S/C20H25N5/c1-3-24-6-8-25(9-7-24)14-16-4-5-19(21-12-16)18-11-17-13-22-23-20(17)10-15(18)2/h4-5,10-13H,3,6-9,14H2,1-2H3,(H,22,23) |
| InChIKey | XKEHBGFGFZQCLH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |