C25H41N7 — CID 161377153
5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-amine;4-methyl-3-[(4-methylpiperazin-1-yl)methyl]aniline (PubChem CID 161377153) has the molecular formula C25H41N7 and a molecular weight of 439.65 g/mol. Its IUPAC name is 5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-amine;4-methyl-3-[(4-methylpiperazin-1-yl)methyl]aniline.
| Compound Name | 5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-amine;4-methyl-3-[(4-methylpiperazin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 161377153 |
| Molecular Formula | C25H41N7 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.34 |
| IUPAC Name | 5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-amine;4-methyl-3-[(4-methylpiperazin-1-yl)methyl]aniline |
| SMILES | CCN1CCN(Cc2ccc(N)nc2)CC1.Cc1ccc(N)cc1CN1CCN(C)CC1 |
| InChI | InChI=1S/C13H21N3.C12H20N4/c1-11-3-4-13(14)9-12(11)10-16-7-5-15(2)6-8-16;1-2-15-5-7-16(8-6-15)10-11-3-4-12(13)14-9-11/h3-4,9H,5-8,10,14H2,1-2H3;3-4,9H,2,5-8,10H2,1H3,(H2,13,14) |
| InChIKey | VRFMNVXIAVRDPG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|