About ethane;1-ethylpiperidine;1H-indazole
ethane;1-ethylpiperidine;1H-indazole (PubChem CID 177186365) has the molecular formula C16H27N3
and a molecular weight of 261.41 g/mol. Its IUPAC name is ethane;1-ethylpiperidine;1H-indazole.
Molecular Properties
| Compound Name | ethane;1-ethylpiperidine;1H-indazole |
| PubChem CID | 177186365 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | ethane;1-ethylpiperidine;1H-indazole |
| SMILES | CC.CCN1CCCCC1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.C7H15N.C2H6/c1-2-4-7-6(3-1)5-8-9-7;1-2-8-6-4-3-5-7-8;1-2/h1-5H,(H,8,9);2-7H2,1H3;1-2H3 |
| InChIKey | DZVBXSJBWTZAOC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethylpiperidine;1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethylpiperidine;1H-indazole?
The IUPAC name of ethane;1-ethylpiperidine;1H-indazole (CID 177186365) is ethane;1-ethylpiperidine;1H-indazole.
What is the SMILES notation for ethane;1-ethylpiperidine;1H-indazole?
The canonical SMILES for ethane;1-ethylpiperidine;1H-indazole is CC.CCN1CCCCC1.c1ccc2[nH]ncc2c1.
What is the InChIKey of ethane;1-ethylpiperidine;1H-indazole?
The InChIKey is DZVBXSJBWTZAOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C7H15N.C2H6/c1-2-4-7-6(3-1)5-8-9-7;1-2-8-6-4-3-5-7-8;1-2/h1-5H,(H,8,9);2-7H2,1H3;1-2H3.
What are the key properties of ethane;1-ethylpiperidine;1H-indazole?
ethane;1-ethylpiperidine;1H-indazole has a molecular weight of 261.41 g/mol, XLogP of 4.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethylpiperidine;1H-indazole is sourced from PubChem (CID 177186365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).