About 1H-indazole;(2R)-2-methylpyrrolidine
1H-indazole;(2R)-2-methylpyrrolidine (PubChem CID 159382960) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is 1H-indazole;(2R)-2-methylpyrrolidine.
Molecular Properties
| Compound Name | 1H-indazole;(2R)-2-methylpyrrolidine |
| PubChem CID | 159382960 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1H-indazole;(2R)-2-methylpyrrolidine |
| SMILES | C[C@@H]1CCCN1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C7H6N2.C5H11N/c1-2-4-7-6(3-1)5-8-9-7;1-5-3-2-4-6-5/h1-5H,(H,8,9);5-6H,2-4H2,1H3/t;5-/m.1/s1 |
| InChIKey | LLDJUHOLZUQDEI-QDXATWJZSA-N |
| XLogP | 2.32 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazole;(2R)-2-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole;(2R)-2-methylpyrrolidine?
The IUPAC name of 1H-indazole;(2R)-2-methylpyrrolidine (CID 159382960) is 1H-indazole;(2R)-2-methylpyrrolidine.
What is the SMILES notation for 1H-indazole;(2R)-2-methylpyrrolidine?
The canonical SMILES for 1H-indazole;(2R)-2-methylpyrrolidine is C[C@@H]1CCCN1.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole;(2R)-2-methylpyrrolidine?
The InChIKey is LLDJUHOLZUQDEI-QDXATWJZSA-N. The full InChI is InChI=1S/C7H6N2.C5H11N/c1-2-4-7-6(3-1)5-8-9-7;1-5-3-2-4-6-5/h1-5H,(H,8,9);5-6H,2-4H2,1H3/t;5-/m.1/s1.
What are the key properties of 1H-indazole;(2R)-2-methylpyrrolidine?
1H-indazole;(2R)-2-methylpyrrolidine has a molecular weight of 203.29 g/mol, XLogP of 2.32, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole;(2R)-2-methylpyrrolidine is sourced from PubChem (CID 159382960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).