C22H23N3O6S2 — CID 135264886
(2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(thiophen-2-ylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 135264886) has the molecular formula C22H23N3O6S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(thiophen-2-ylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(thiophen-2-ylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 135264886 |
| Molecular Formula | C22H23N3O6S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.10 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(thiophen-2-ylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CN(C(=O)[C@H](Cc1ccccc1)NC(O)NS(=O)(=O)c1cccs1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H23N3O6S2/c1-25(16-9-10-18-19(13-16)31-14-30-18)21(26)17(12-15-6-3-2-4-7-15)23-22(27)24-33(28,29)20-8-5-11-32-20/h2-11,13,17,22-24,27H,12,14H2,1H3/t17-,22?/m0/s1 |
| InChIKey | JAVYVDAOOCDBTK-LBOXEOMUSA-N |
| XLogP | 1.89 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|