C27H31N3O6S — CID 135264900
(2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(3-phenylpropylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 135264900) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(3-phenylpropylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(3-phenylpropylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 135264900 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(3-phenylpropylsulfonylamino)methyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CN(C(=O)[C@H](Cc1ccccc1)NC(O)NS(=O)(=O)CCCc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H31N3O6S/c1-30(22-14-15-24-25(18-22)36-19-35-24)26(31)23(17-21-11-6-3-7-12-21)28-27(32)29-37(33,34)16-8-13-20-9-4-2-5-10-20/h2-7,9-12,14-15,18,23,27-29,32H,8,13,16-17,19H2,1H3/t23-,27?/m0/s1 |
| InChIKey | HQJIHXLLWSFBFS-DCCUJTHKSA-N |
| XLogP | 2.41 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|