C16H27N3OS — CID 135265947
[(E)-6-(ethenylamino)-3-methylhex-1-enyl] 2-[(1-methylcyclopropyl)methylamino]-2-oxoethanimidothioate (PubChem CID 135265947) has the molecular formula C16H27N3OS and a molecular weight of 309.48 g/mol. Its IUPAC name is [(E)-6-(ethenylamino)-3-methylhex-1-enyl] 2-[(1-methylcyclopropyl)methylamino]-2-oxoethanimidothioate.
| Compound Name | [(E)-6-(ethenylamino)-3-methylhex-1-enyl] 2-[(1-methylcyclopropyl)methylamino]-2-oxoethanimidothioate |
|---|---|
| PubChem CID | 135265947 |
| Molecular Formula | C16H27N3OS |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | [(E)-6-(ethenylamino)-3-methylhex-1-enyl] 2-[(1-methylcyclopropyl)methylamino]-2-oxoethanimidothioate |
| SMILES | [H]/N=C(\S/C=C/C(C)CCCNC=C)C(=O)NCC1(C)CC1 |
| InChI | InChI=1S/C16H27N3OS/c1-4-18-10-5-6-13(2)7-11-21-14(17)15(20)19-12-16(3)8-9-16/h4,7,11,13,17-18H,1,5-6,8-10,12H2,2-3H3,(H,19,20)/b11-7+,17-14- |
| InChIKey | CSUWTJGRFFKLSS-LNUOCBTKSA-N |
| XLogP | 3.28 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|