C12H14N4 — CID 135268156
6-[(3S)-3-ethenylpiperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 135268156) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 6-[(3S)-3-ethenylpiperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[(3S)-3-ethenylpiperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135268156 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 6-[(3S)-3-ethenylpiperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | C=C[C@H]1CN(c2ccc(C#N)cn2)CCN1 |
| InChI | InChI=1S/C12H14N4/c1-2-11-9-16(6-5-14-11)12-4-3-10(7-13)8-15-12/h2-4,8,11,14H,1,5-6,9H2/t11-/m0/s1 |
| InChIKey | NRBJKJFOYLQULL-NSHDSACASA-N |
| XLogP | 0.92 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|