C13H13N5O2 — CID 71860442
6-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)pyridine-3-carbonitrile (PubChem CID 71860442) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 6-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)pyridine-3-carbonitrile.
| Compound Name | 6-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 71860442 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 6-(6,7-dioxo-1,3,4,8,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(N2CCN3C(=O)C(=O)NCC3C2)nc1 |
| InChI | InChI=1S/C13H13N5O2/c14-5-9-1-2-11(15-6-9)17-3-4-18-10(8-17)7-16-12(19)13(18)20/h1-2,6,10H,3-4,7-8H2,(H,16,19) |
| InChIKey | TYRWLELTJUBNJC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|