C13H16FN3S — CID 135269122
2-(4-fluorocyclohexa-2,4-dien-1-yl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanimidamide (PubChem CID 135269122) has the molecular formula C13H16FN3S and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanimidamide.
| Compound Name | 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanimidamide |
|---|---|
| PubChem CID | 135269122 |
| Molecular Formula | C13H16FN3S |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-(4-fluorocyclohexa-2,4-dien-1-yl)-N'-[(5-methyl-1,3-thiazol-2-yl)methyl]ethanimidamide |
| SMILES | Cc1cnc(C/N=C(\N)CC2C=CC(F)=CC2)s1 |
| InChI | InChI=1S/C13H16FN3S/c1-9-7-17-13(18-9)8-16-12(15)6-10-2-4-11(14)5-3-10/h2,4-5,7,10H,3,6,8H2,1H3,(H2,15,16) |
| InChIKey | PVMFZLGQZYXOHL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|