C12H18N2S — CID 115756994
1-cyclohex-3-en-1-yl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine (PubChem CID 115756994) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine.
| Compound Name | 1-cyclohex-3-en-1-yl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 115756994 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine |
| SMILES | Cc1cnc(CNCC2CC=CCC2)s1 |
| InChI | InChI=1S/C12H18N2S/c1-10-7-14-12(15-10)9-13-8-11-5-3-2-4-6-11/h2-3,7,11,13H,4-6,8-9H2,1H3 |
| InChIKey | QJZSYPDXJLDIQI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|