C21H28N4O — CID 135273479
4-[5-[(2,6-dimethylpyrimidin-4-yl)amino]-4-methanimidoyl-2-methylphenyl]-1-methylcyclohexan-1-ol (PubChem CID 135273479) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[5-[(2,6-dimethylpyrimidin-4-yl)amino]-4-methanimidoyl-2-methylphenyl]-1-methylcyclohexan-1-ol.
| Compound Name | 4-[5-[(2,6-dimethylpyrimidin-4-yl)amino]-4-methanimidoyl-2-methylphenyl]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 135273479 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | 4-[5-[(2,6-dimethylpyrimidin-4-yl)amino]-4-methanimidoyl-2-methylphenyl]-1-methylcyclohexan-1-ol |
| SMILES | [H]/N=C/c1cc(C)c(C2CCC(C)(O)CC2)cc1Nc1cc(C)nc(C)n1 |
| InChI | InChI=1S/C21H28N4O/c1-13-9-17(12-22)19(25-20-10-14(2)23-15(3)24-20)11-18(13)16-5-7-21(4,26)8-6-16/h9-12,16,22,26H,5-8H2,1-4H3,(H,23,24,25)/b22-12+ |
| InChIKey | QVYHTGXWZOMHOQ-WSDLNYQXSA-N |
| XLogP | 4.55 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|