C23H34N6O3 — CID 145234182
N-(2-methanimidoyl-4-methyl-5-piperidin-4-ylphenyl)-2-methoxy-6-morpholin-4-ylpyrimidin-4-amine;methanol (PubChem CID 145234182) has the molecular formula C23H34N6O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-(2-methanimidoyl-4-methyl-5-piperidin-4-ylphenyl)-2-methoxy-6-morpholin-4-ylpyrimidin-4-amine;methanol.
| Compound Name | N-(2-methanimidoyl-4-methyl-5-piperidin-4-ylphenyl)-2-methoxy-6-morpholin-4-ylpyrimidin-4-amine;methanol |
|---|---|
| PubChem CID | 145234182 |
| Molecular Formula | C23H34N6O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N-(2-methanimidoyl-4-methyl-5-piperidin-4-ylphenyl)-2-methoxy-6-morpholin-4-ylpyrimidin-4-amine;methanol |
| SMILES | CO.[H]/N=C/c1cc(C)c(C2CCNCC2)cc1Nc1cc(N2CCOCC2)nc(OC)n1 |
| InChI | InChI=1S/C22H30N6O2.CH4O/c1-15-11-17(14-23)19(12-18(15)16-3-5-24-6-4-16)25-20-13-21(27-22(26-20)29-2)28-7-9-30-10-8-28;1-2/h11-14,16,23-24H,3-10H2,1-2H3,(H,25,26,27);2H,1H3/b23-14+; |
| InChIKey | SJCLKGVJTGIFPI-MHVDTSALSA-N |
| XLogP | 2.45 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|