C22H32FN7O2 — CID 145234221
1-[6-[5-[(1R)-4-[aminomethyl(methyl)amino]-1-fluorobutyl]-2-methanimidoyl-4-methylanilino]-2-methoxypyrimidin-4-yl]azetidin-3-ol (PubChem CID 145234221) has the molecular formula C22H32FN7O2 and a molecular weight of 445.54 g/mol. Its IUPAC name is 1-[6-[5-[(1R)-4-[aminomethyl(methyl)amino]-1-fluorobutyl]-2-methanimidoyl-4-methylanilino]-2-methoxypyrimidin-4-yl]azetidin-3-ol.
| Compound Name | 1-[6-[5-[(1R)-4-[aminomethyl(methyl)amino]-1-fluorobutyl]-2-methanimidoyl-4-methylanilino]-2-methoxypyrimidin-4-yl]azetidin-3-ol |
|---|---|
| PubChem CID | 145234221 |
| Molecular Formula | C22H32FN7O2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 1-[6-[5-[(1R)-4-[aminomethyl(methyl)amino]-1-fluorobutyl]-2-methanimidoyl-4-methylanilino]-2-methoxypyrimidin-4-yl]azetidin-3-ol |
| SMILES | [H]/N=C/c1cc(C)c([C@H](F)CCCN(C)CN)cc1Nc1cc(N2CC(O)C2)nc(OC)n1 |
| InChI | InChI=1S/C22H32FN7O2/c1-14-7-15(10-24)19(8-17(14)18(23)5-4-6-29(2)13-25)26-20-9-21(28-22(27-20)32-3)30-11-16(31)12-30/h7-10,16,18,24,31H,4-6,11-13,25H2,1-3H3,(H,26,27,28)/b24-10+/t18-/m1/s1 |
| InChIKey | XTZNLGSOPPVYBV-ATXJHCGVSA-N |
| XLogP | 2.35 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|