C26H54O3 — CID 135274521
4-ethyl-4-[2-[2-ethyl-4-methyl-2-(2-methylpropyl)pentyl]peroxyethoxymethyl]-2,6-dimethylheptane (PubChem CID 135274521) has the molecular formula C26H54O3 and a molecular weight of 414.72 g/mol. Its IUPAC name is 4-ethyl-4-[2-[2-ethyl-4-methyl-2-(2-methylpropyl)pentyl]peroxyethoxymethyl]-2,6-dimethylheptane.
| Compound Name | 4-ethyl-4-[2-[2-ethyl-4-methyl-2-(2-methylpropyl)pentyl]peroxyethoxymethyl]-2,6-dimethylheptane |
|---|---|
| PubChem CID | 135274521 |
| Molecular Formula | C26H54O3 |
| Molecular Weight | 414.72 g/mol |
| Exact Mass | 414.41 |
| IUPAC Name | 4-ethyl-4-[2-[2-ethyl-4-methyl-2-(2-methylpropyl)pentyl]peroxyethoxymethyl]-2,6-dimethylheptane |
| SMILES | CCC(COCCOOCC(CC)(CC(C)C)CC(C)C)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C26H54O3/c1-11-25(15-21(3)4,16-22(5)6)19-27-13-14-28-29-20-26(12-2,17-23(7)8)18-24(9)10/h21-24H,11-20H2,1-10H3 |
| InChIKey | VWXPBOFKVCGGHM-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.72 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|