C23H28FN4O2+ — CID 135278699
[6-(4-ethenyl-4-fluorocyclohexyl)oxy-5-(7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-3-pyridinyl]methanamine (PubChem CID 135278699) has the molecular formula C23H28FN4O2+ and a molecular weight of 411.50 g/mol. Its IUPAC name is [6-(4-ethenyl-4-fluorocyclohexyl)oxy-5-(7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-3-pyridinyl]methanamine.
| Compound Name | [6-(4-ethenyl-4-fluorocyclohexyl)oxy-5-(7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-3-pyridinyl]methanamine |
|---|---|
| PubChem CID | 135278699 |
| Molecular Formula | C23H28FN4O2+ |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [6-(4-ethenyl-4-fluorocyclohexyl)oxy-5-(7-methoxy-6-methyl-1H-pyrrolo[2,3-b]pyridin-7-ium-4-yl)-3-pyridinyl]methanamine |
| SMILES | C=CC1(F)CCC(Oc2ncc(CN)cc2-c2cc(C)[n+](OC)c3[nH]ccc23)CC1 |
| InChI | InChI=1S/C23H27FN4O2/c1-4-23(24)8-5-17(6-9-23)30-22-20(12-16(13-25)14-27-22)19-11-15(2)28(29-3)21-18(19)7-10-26-21/h4,7,10-12,14,17H,1,5-6,8-9,13,25H2,2-3H3/p+1 |
| InChIKey | QINOBYYSAYMIIP-UHFFFAOYSA-O |
| XLogP | 3.56 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|