C20H23FN6O3 — CID 23646062
6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-amine (PubChem CID 23646062) has the molecular formula C20H23FN6O3 and a molecular weight of 414.44 g/mol. Its IUPAC name is 6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-amine.
| Compound Name | 6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23646062 |
| Molecular Formula | C20H23FN6O3 |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]-5-[(E)-2-morpholin-4-ylethoxyiminomethyl]pyrimidin-4-amine |
| SMILES | Cc1cc2c(F)c(Oc3ncnc(N)c3/C=N/OCCN3CCOCC3)ccc2[nH]1 |
| InChI | InChI=1S/C20H23FN6O3/c1-13-10-14-16(26-13)2-3-17(18(14)21)30-20-15(19(22)23-12-24-20)11-25-29-9-6-27-4-7-28-8-5-27/h2-3,10-12,26H,4-9H2,1H3,(H2,22,23,24)/b25-11+ |
| InChIKey | QZTBTAQOCQKRRB-OPEKNORGSA-N |
| XLogP | 2.46 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|