C18H28N2O6 — CID 135279212
3-(3-methoxypropoxymethyl)-5-[2-[3-(5-methyl-1,2-oxazol-3-yl)propoxy]ethoxymethyl]-1,2-oxazole (PubChem CID 135279212) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is 3-(3-methoxypropoxymethyl)-5-[2-[3-(5-methyl-1,2-oxazol-3-yl)propoxy]ethoxymethyl]-1,2-oxazole.
| Compound Name | 3-(3-methoxypropoxymethyl)-5-[2-[3-(5-methyl-1,2-oxazol-3-yl)propoxy]ethoxymethyl]-1,2-oxazole |
|---|---|
| PubChem CID | 135279212 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 3-(3-methoxypropoxymethyl)-5-[2-[3-(5-methyl-1,2-oxazol-3-yl)propoxy]ethoxymethyl]-1,2-oxazole |
| SMILES | COCCCOCc1cc(COCCOCCCc2cc(C)on2)on1 |
| InChI | InChI=1S/C18H28N2O6/c1-15-11-16(19-25-15)5-3-7-22-9-10-24-14-18-12-17(20-26-18)13-23-8-4-6-21-2/h11-12H,3-10,13-14H2,1-2H3 |
| InChIKey | HNXPWKCUATWAMS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 88.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|