C13H25NO3 — CID 142597075
ethane;3-(5-methoxypentoxymethyl)-5-methyl-1,2-oxazole (PubChem CID 142597075) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is ethane;3-(5-methoxypentoxymethyl)-5-methyl-1,2-oxazole.
| Compound Name | ethane;3-(5-methoxypentoxymethyl)-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 142597075 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | ethane;3-(5-methoxypentoxymethyl)-5-methyl-1,2-oxazole |
| SMILES | CC.COCCCCCOCc1cc(C)on1 |
| InChI | InChI=1S/C11H19NO3.C2H6/c1-10-8-11(12-15-10)9-14-7-5-3-4-6-13-2;1-2/h8H,3-7,9H2,1-2H3;1-2H3 |
| InChIKey | GFNUECXLFKQANJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|