C9H16N2O2 — CID 62337039
N-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]ethanamine (PubChem CID 62337039) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]ethanamine.
| Compound Name | N-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]ethanamine |
|---|---|
| PubChem CID | 62337039 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-ethyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]ethanamine |
| SMILES | CCNCCOCc1cc(C)on1 |
| InChI | InChI=1S/C9H16N2O2/c1-3-10-4-5-12-7-9-6-8(2)13-11-9/h6,10H,3-5,7H2,1-2H3 |
| InChIKey | YXIDWPQCSHDREC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|