C15H25NO2 — CID 135280886
N-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-oxobutanamide (PubChem CID 135280886) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-oxobutanamide.
| Compound Name | N-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 135280886 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | N-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)NC1(C)CC2CC(C)CC(C2)C1 |
| InChI | InChI=1S/C15H25NO2/c1-10-4-12-7-13(5-10)9-15(3,8-12)16-14(18)6-11(2)17/h10,12-13H,4-9H2,1-3H3,(H,16,18) |
| InChIKey | DILBMOPVJONQDC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|