C12H22N2O — CID 145237634
[(5S)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]urea (PubChem CID 145237634) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is [(5S)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]urea.
| Compound Name | [(5S)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]urea |
|---|---|
| PubChem CID | 145237634 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | [(5S)-3,7-dimethyl-3-bicyclo[3.3.1]nonanyl]urea |
| SMILES | CC1CC2C[C@H](C1)CC(C)(NC(N)=O)C2 |
| InChI | InChI=1S/C12H22N2O/c1-8-3-9-5-10(4-8)7-12(2,6-9)14-11(13)15/h8-10H,3-7H2,1-2H3,(H3,13,14,15)/t8?,9-,10?,12?/m0/s1 |
| InChIKey | NEQWWWDLRVFTJA-TXKMRWCBSA-N |
| XLogP | 2.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |