C13H25NO5S2 — CID 134285788
2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)sulfonylamino]ethanesulfonic acid (PubChem CID 134285788) has the molecular formula C13H25NO5S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)sulfonylamino]ethanesulfonic acid.
| Compound Name | 2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)sulfonylamino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134285788 |
| Molecular Formula | C13H25NO5S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 2-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)sulfonylamino]ethanesulfonic acid |
| SMILES | CC1CC2CC(C1)CC(C)(S(=O)(=O)NCCS(=O)(=O)O)C2 |
| InChI | InChI=1S/C13H25NO5S2/c1-10-5-11-7-12(6-10)9-13(2,8-11)21(18,19)14-3-4-20(15,16)17/h10-12,14H,3-9H2,1-2H3,(H,15,16,17) |
| InChIKey | FEMOXVZRUAZTGD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|