C14H27NO4S — CID 121297120
2-[[(3S)-1,3,5-trimethylcyclooctanecarbonyl]amino]ethanesulfonic acid (PubChem CID 121297120) has the molecular formula C14H27NO4S and a molecular weight of 305.44 g/mol. Its IUPAC name is 2-[[(3S)-1,3,5-trimethylcyclooctanecarbonyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(3S)-1,3,5-trimethylcyclooctanecarbonyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 121297120 |
| Molecular Formula | C14H27NO4S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 2-[[(3S)-1,3,5-trimethylcyclooctanecarbonyl]amino]ethanesulfonic acid |
| SMILES | CC1CCCC(C)(C(=O)NCCS(=O)(=O)O)C[C@@H](C)C1 |
| InChI | InChI=1S/C14H27NO4S/c1-11-5-4-6-14(3,10-12(2)9-11)13(16)15-7-8-20(17,18)19/h11-12H,4-10H2,1-3H3,(H,15,16)(H,17,18,19)/t11?,12-,14?/m0/s1 |
| InChIKey | BMWNCLAVRBLEQX-LXVYMNJGSA-N |
| XLogP | 2.23 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|