C15H29NO5S — CID 121297053
3-[[(3S)-1,3,5-trimethylcyclooctyl]oxycarbonylamino]propane-1-sulfonic acid (PubChem CID 121297053) has the molecular formula C15H29NO5S and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-[[(3S)-1,3,5-trimethylcyclooctyl]oxycarbonylamino]propane-1-sulfonic acid.
| Compound Name | 3-[[(3S)-1,3,5-trimethylcyclooctyl]oxycarbonylamino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 121297053 |
| Molecular Formula | C15H29NO5S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 3-[[(3S)-1,3,5-trimethylcyclooctyl]oxycarbonylamino]propane-1-sulfonic acid |
| SMILES | CC1CCCC(C)(OC(=O)NCCCS(=O)(=O)O)C[C@@H](C)C1 |
| InChI | InChI=1S/C15H29NO5S/c1-12-6-4-7-15(3,11-13(2)10-12)21-14(17)16-8-5-9-22(18,19)20/h12-13H,4-11H2,1-3H3,(H,16,17)(H,18,19,20)/t12?,13-,15?/m0/s1 |
| InChIKey | PBVWNNKRMMUWIR-OWYJLGKBSA-N |
| XLogP | 2.99 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|