C11H23NO3S — CID 88896171
3-[(2,5-dimethylcyclohexyl)amino]propane-1-sulfonic acid (PubChem CID 88896171) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-[(2,5-dimethylcyclohexyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[(2,5-dimethylcyclohexyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 88896171 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-[(2,5-dimethylcyclohexyl)amino]propane-1-sulfonic acid |
| SMILES | CC1CCC(C)C(NCCCS(=O)(=O)O)C1 |
| InChI | InChI=1S/C11H23NO3S/c1-9-4-5-10(2)11(8-9)12-6-3-7-16(13,14)15/h9-12H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | FKFAKPVTNHHSSO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|