C15H34N2O3S — CID 87233170
3-(cyclohexylamino)propane-1-sulfonic acid;N,N-diethylethanamine (PubChem CID 87233170) has the molecular formula C15H34N2O3S and a molecular weight of 322.52 g/mol. Its IUPAC name is 3-(cyclohexylamino)propane-1-sulfonic acid;N,N-diethylethanamine.
| Compound Name | 3-(cyclohexylamino)propane-1-sulfonic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 87233170 |
| Molecular Formula | C15H34N2O3S |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 3-(cyclohexylamino)propane-1-sulfonic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.O=S(=O)(O)CCCNC1CCCCC1 |
| InChI | InChI=1S/C9H19NO3S.C6H15N/c11-14(12,13)8-4-7-10-9-5-2-1-3-6-9;1-4-7(5-2)6-3/h9-10H,1-8H2,(H,11,12,13);4-6H2,1-3H3 |
| InChIKey | GAGKAKZBFGJQOK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|