About N-propylcyclohexanamine;sulfuric acid
N-propylcyclohexanamine;sulfuric acid (PubChem CID 22994805) has the molecular formula C9H21NO4S
and a molecular weight of 239.34 g/mol. Its IUPAC name is N-propylcyclohexanamine;sulfuric acid.
Molecular Properties
| Compound Name | N-propylcyclohexanamine;sulfuric acid |
| PubChem CID | 22994805 |
| Molecular Formula | C9H21NO4S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-propylcyclohexanamine;sulfuric acid |
| SMILES | CCCNC1CCCCC1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H19N.H2O4S/c1-2-8-10-9-6-4-3-5-7-9;1-5(2,3)4/h9-10H,2-8H2,1H3;(H2,1,2,3,4) |
| InChIKey | USNSZDGGVXIHTC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-propylcyclohexanamine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propylcyclohexanamine;sulfuric acid?
The IUPAC name of N-propylcyclohexanamine;sulfuric acid (CID 22994805) is N-propylcyclohexanamine;sulfuric acid.
What is the SMILES notation for N-propylcyclohexanamine;sulfuric acid?
The canonical SMILES for N-propylcyclohexanamine;sulfuric acid is CCCNC1CCCCC1.O=S(=O)(O)O.
What is the InChIKey of N-propylcyclohexanamine;sulfuric acid?
The InChIKey is USNSZDGGVXIHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.H2O4S/c1-2-8-10-9-6-4-3-5-7-9;1-5(2,3)4/h9-10H,2-8H2,1H3;(H2,1,2,3,4).
What are the key properties of N-propylcyclohexanamine;sulfuric acid?
N-propylcyclohexanamine;sulfuric acid has a molecular weight of 239.34 g/mol, XLogP of 1.67, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propylcyclohexanamine;sulfuric acid is sourced from PubChem (CID 22994805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).