C26H39N3O — CID 154645551
1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-[(E)-4-imino-6-phenyloct-5-enyl]urea (PubChem CID 154645551) has the molecular formula C26H39N3O and a molecular weight of 409.62 g/mol. Its IUPAC name is 1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-[(E)-4-imino-6-phenyloct-5-enyl]urea.
| Compound Name | 1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-[(E)-4-imino-6-phenyloct-5-enyl]urea |
|---|---|
| PubChem CID | 154645551 |
| Molecular Formula | C26H39N3O |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.31 |
| IUPAC Name | 1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-3-[(E)-4-imino-6-phenyloct-5-enyl]urea |
| SMILES | [H]/N=C(\C=C(/CC)c1ccccc1)CCCNC(=O)NC1(C)CC2CC(C)CC(C2)C1 |
| InChI | InChI=1S/C26H39N3O/c1-4-22(23-9-6-5-7-10-23)16-24(27)11-8-12-28-25(30)29-26(3)17-20-13-19(2)14-21(15-20)18-26/h5-7,9-10,16,19-21,27H,4,8,11-15,17-18H2,1-3H3,(H2,28,29,30)/b22-16+,27-24- |
| InChIKey | JJBWHRVSBKARDU-SHQKSRGUSA-N |
| XLogP | 6.18 |
| TPSA | 64.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|