C11H22N4O2 — CID 40534520
[(1S,4S)-4-(carbamoylamino)-1,3,3-trimethylcyclohexyl]urea (PubChem CID 40534520) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is [(1S,4S)-4-(carbamoylamino)-1,3,3-trimethylcyclohexyl]urea.
| Compound Name | [(1S,4S)-4-(carbamoylamino)-1,3,3-trimethylcyclohexyl]urea |
|---|---|
| PubChem CID | 40534520 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | [(1S,4S)-4-(carbamoylamino)-1,3,3-trimethylcyclohexyl]urea |
| SMILES | CC1(C)C[C@@](C)(NC(N)=O)CC[C@@H]1NC(N)=O |
| InChI | InChI=1S/C11H22N4O2/c1-10(2)6-11(3,15-9(13)17)5-4-7(10)14-8(12)16/h7H,4-6H2,1-3H3,(H3,12,14,16)(H3,13,15,17)/t7-,11-/m0/s1 |
| InChIKey | NBARGYGCNYLHDC-CPCISQLKSA-N |
| XLogP | 0.66 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |