C7H14N2O2 — CID 130700520
(4,4-dimethyloxolan-3-yl)urea (PubChem CID 130700520) has the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. Its IUPAC name is (4,4-dimethyloxolan-3-yl)urea.
| Compound Name | (4,4-dimethyloxolan-3-yl)urea |
|---|---|
| PubChem CID | 130700520 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | (4,4-dimethyloxolan-3-yl)urea |
| SMILES | CC1(C)COCC1NC(N)=O |
| InChI | InChI=1S/C7H14N2O2/c1-7(2)4-11-3-5(7)9-6(8)10/h5H,3-4H2,1-2H3,(H3,8,9,10) |
| InChIKey | CYIQGCLDXNNSIF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |