C9H17NO3S — CID 130729696
N-(1,1-dioxothietan-3-yl)-4,4-dimethyloxolan-3-amine (PubChem CID 130729696) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N-(1,1-dioxothietan-3-yl)-4,4-dimethyloxolan-3-amine.
| Compound Name | N-(1,1-dioxothietan-3-yl)-4,4-dimethyloxolan-3-amine |
|---|---|
| PubChem CID | 130729696 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N-(1,1-dioxothietan-3-yl)-4,4-dimethyloxolan-3-amine |
| SMILES | CC1(C)COCC1NC1CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO3S/c1-9(2)6-13-3-8(9)10-7-4-14(11,12)5-7/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | YDTZUHANXKTJCP-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |