C10H19NO2S — CID 130532869
N-(2,2-dimethylcyclobutyl)-1,1-dioxothiolan-3-amine (PubChem CID 130532869) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-(2,2-dimethylcyclobutyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2,2-dimethylcyclobutyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 130532869 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-(2,2-dimethylcyclobutyl)-1,1-dioxothiolan-3-amine |
| SMILES | CC1(C)CCC1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H19NO2S/c1-10(2)5-3-9(10)11-8-4-6-14(12,13)7-8/h8-9,11H,3-7H2,1-2H3 |
| InChIKey | DECGRGVJNKRKNC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |