C12H23NO2S2 — CID 79948037
N-(1,1-dioxothian-3-yl)-4,4-dimethylthian-3-amine (PubChem CID 79948037) has the molecular formula C12H23NO2S2 and a molecular weight of 277.45 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-4,4-dimethylthian-3-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 79948037 |
| Molecular Formula | C12H23NO2S2 |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCSCC1NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H23NO2S2/c1-12(2)5-6-16-8-11(12)13-10-4-3-7-17(14,15)9-10/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | TXDVMVHITCXJOA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |