C14H27NS — CID 114544200
N-(3,3-dimethylcyclopentyl)-4,4-dimethylthian-3-amine (PubChem CID 114544200) has the molecular formula C14H27NS and a molecular weight of 241.44 g/mol. Its IUPAC name is N-(3,3-dimethylcyclopentyl)-4,4-dimethylthian-3-amine.
| Compound Name | N-(3,3-dimethylcyclopentyl)-4,4-dimethylthian-3-amine |
|---|---|
| PubChem CID | 114544200 |
| Molecular Formula | C14H27NS |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | N-(3,3-dimethylcyclopentyl)-4,4-dimethylthian-3-amine |
| SMILES | CC1(C)CCC(NC2CSCCC2(C)C)C1 |
| InChI | InChI=1S/C14H27NS/c1-13(2)6-5-11(9-13)15-12-10-16-8-7-14(12,3)4/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | QFEMXICRSXITDL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |