C14H26N2OS — CID 79948097
4-[(4,4-dimethylthian-3-yl)amino]cyclohexane-1-carboxamide (PubChem CID 79948097) has the molecular formula C14H26N2OS and a molecular weight of 270.44 g/mol. Its IUPAC name is 4-[(4,4-dimethylthian-3-yl)amino]cyclohexane-1-carboxamide.
| Compound Name | 4-[(4,4-dimethylthian-3-yl)amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 79948097 |
| Molecular Formula | C14H26N2OS |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 4-[(4,4-dimethylthian-3-yl)amino]cyclohexane-1-carboxamide |
| SMILES | CC1(C)CCSCC1NC1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C14H26N2OS/c1-14(2)7-8-18-9-12(14)16-11-5-3-10(4-6-11)13(15)17/h10-12,16H,3-9H2,1-2H3,(H2,15,17) |
| InChIKey | SGGSNQAKPLEIME-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |