C15H28N2S — CID 79949021
N-(4,4-dimethylthian-3-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 79949021) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is N-(4,4-dimethylthian-3-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-(4,4-dimethylthian-3-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 79949021 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | N-(4,4-dimethylthian-3-yl)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CC1(C)CCSCC1NC1CCN2CCCCC12 |
| InChI | InChI=1S/C15H28N2S/c1-15(2)7-10-18-11-14(15)16-12-6-9-17-8-4-3-5-13(12)17/h12-14,16H,3-11H2,1-2H3 |
| InChIKey | YVJNPNUKEAIDKG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |