C10H20N2O2S — CID 106170755
3-[(4,4-dimethylthian-3-yl)amino]-2-hydroxypropanamide (PubChem CID 106170755) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-[(4,4-dimethylthian-3-yl)amino]-2-hydroxypropanamide.
| Compound Name | 3-[(4,4-dimethylthian-3-yl)amino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 106170755 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-[(4,4-dimethylthian-3-yl)amino]-2-hydroxypropanamide |
| SMILES | CC1(C)CCSCC1NCC(O)C(N)=O |
| InChI | InChI=1S/C10H20N2O2S/c1-10(2)3-4-15-6-8(10)12-5-7(13)9(11)14/h7-8,12-13H,3-6H2,1-2H3,(H2,11,14) |
| InChIKey | ZUYWLMFSWRQVED-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |