C11H22N2OS — CID 79948277
2-[(4,4-dimethylthian-3-yl)amino]-2-methylpropanamide (PubChem CID 79948277) has the molecular formula C11H22N2OS and a molecular weight of 230.38 g/mol. Its IUPAC name is 2-[(4,4-dimethylthian-3-yl)amino]-2-methylpropanamide.
| Compound Name | 2-[(4,4-dimethylthian-3-yl)amino]-2-methylpropanamide |
|---|---|
| PubChem CID | 79948277 |
| Molecular Formula | C11H22N2OS |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2-[(4,4-dimethylthian-3-yl)amino]-2-methylpropanamide |
| SMILES | CC(C)(NC1CSCCC1(C)C)C(N)=O |
| InChI | InChI=1S/C11H22N2OS/c1-10(2)5-6-15-7-8(10)13-11(3,4)9(12)14/h8,13H,5-7H2,1-4H3,(H2,12,14) |
| InChIKey | FLABKSSBVRZIDI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |