C21H17N7 — CID 135281122
N-(1-phenylethyl)-6-(1H-pyrazolo[3,4-d]pyrimidin-4-yl)quinazolin-2-amine (PubChem CID 135281122) has the molecular formula C21H17N7 and a molecular weight of 367.42 g/mol. Its IUPAC name is N-(1-phenylethyl)-6-(1H-pyrazolo[3,4-d]pyrimidin-4-yl)quinazolin-2-amine.
| Compound Name | N-(1-phenylethyl)-6-(1H-pyrazolo[3,4-d]pyrimidin-4-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 135281122 |
| Molecular Formula | C21H17N7 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-(1-phenylethyl)-6-(1H-pyrazolo[3,4-d]pyrimidin-4-yl)quinazolin-2-amine |
| SMILES | CC(Nc1ncc2cc(-c3ncnc4[nH]ncc34)ccc2n1)c1ccccc1 |
| InChI | InChI=1S/C21H17N7/c1-13(14-5-3-2-4-6-14)26-21-22-10-16-9-15(7-8-18(16)27-21)19-17-11-25-28-20(17)24-12-23-19/h2-13H,1H3,(H,22,26,27)(H,23,24,25,28) |
| InChIKey | KYPNKQIQCVXLPB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |