C10H11F3N2O3 — CID 135284077
5-(1-methylpyrazol-4-yl)-5-oxo-3-(trifluoromethyl)pentanoic acid (PubChem CID 135284077) has the molecular formula C10H11F3N2O3 and a molecular weight of 264.20 g/mol. Its IUPAC name is 5-(1-methylpyrazol-4-yl)-5-oxo-3-(trifluoromethyl)pentanoic acid.
| Compound Name | 5-(1-methylpyrazol-4-yl)-5-oxo-3-(trifluoromethyl)pentanoic acid |
|---|---|
| PubChem CID | 135284077 |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-(1-methylpyrazol-4-yl)-5-oxo-3-(trifluoromethyl)pentanoic acid |
| SMILES | Cn1cc(C(=O)CC(CC(=O)O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H11F3N2O3/c1-15-5-6(4-14-15)8(16)2-7(3-9(17)18)10(11,12)13/h4-5,7H,2-3H2,1H3,(H,17,18) |
| InChIKey | FBBBWTBCAKRQMN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |