C9H6ClF2N3O2S2 — CID 135284298
4-(chloromethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 135284298) has the molecular formula C9H6ClF2N3O2S2 and a molecular weight of 325.75 g/mol. Its IUPAC name is 4-(chloromethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-(chloromethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135284298 |
| Molecular Formula | C9H6ClF2N3O2S2 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 4-(chloromethyl)-2,5-difluoro-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ncns1)c1cc(F)c(CCl)cc1F |
| InChI | InChI=1S/C9H6ClF2N3O2S2/c10-3-5-1-7(12)8(2-6(5)11)19(16,17)15-9-13-4-14-18-9/h1-2,4H,3H2,(H,13,14,15) |
| InChIKey | KDYOLECXJAGOMI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|