C20H22ClN3O7S3 — CID 135284311
1-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)sulfamoyl]phenyl]ethyl methanesulfonate (PubChem CID 135284311) has the molecular formula C20H22ClN3O7S3 and a molecular weight of 548.06 g/mol. Its IUPAC name is 1-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)sulfamoyl]phenyl]ethyl methanesulfonate.
| Compound Name | 1-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)sulfamoyl]phenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 135284311 |
| Molecular Formula | C20H22ClN3O7S3 |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | 1-[2-chloro-4-[(2,4-dimethoxyphenyl)methyl-(1,2,4-thiadiazol-5-yl)sulfamoyl]phenyl]ethyl methanesulfonate |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc(C(C)OS(C)(=O)=O)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C20H22ClN3O7S3/c1-13(31-33(4,25)26)17-8-7-16(10-18(17)21)34(27,28)24(20-22-12-23-32-20)11-14-5-6-15(29-2)9-19(14)30-3/h5-10,12-13H,11H2,1-4H3 |
| InChIKey | SNZBLCOOCQWOEK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 124.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|