C18H18BrN3O4S2 — CID 135284123
4-(bromomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 135284123) has the molecular formula C18H18BrN3O4S2 and a molecular weight of 484.40 g/mol. Its IUPAC name is 4-(bromomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135284123 |
| Molecular Formula | C18H18BrN3O4S2 |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 4-(bromomethyl)-N-[(2,4-dimethoxyphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2ccc(CBr)cc2)c(OC)c1 |
| InChI | InChI=1S/C18H18BrN3O4S2/c1-25-15-6-5-14(17(9-15)26-2)11-22(18-20-12-21-27-18)28(23,24)16-7-3-13(10-19)4-8-16/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | RHADMKJDBBIVTC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|