C17H14F3N3O3S2 — CID 67966730
2,4,5-trifluoro-N-[(4-methoxy-2-methylphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 67966730) has the molecular formula C17H14F3N3O3S2 and a molecular weight of 429.45 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-[(4-methoxy-2-methylphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 2,4,5-trifluoro-N-[(4-methoxy-2-methylphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 67966730 |
| Molecular Formula | C17H14F3N3O3S2 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 2,4,5-trifluoro-N-[(4-methoxy-2-methylphenyl)methyl]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2cc(F)c(F)cc2F)c(C)c1 |
| InChI | InChI=1S/C17H14F3N3O3S2/c1-10-5-12(26-2)4-3-11(10)8-23(17-21-9-22-27-17)28(24,25)16-7-14(19)13(18)6-15(16)20/h3-7,9H,8H2,1-2H3 |
| InChIKey | MPXLIJIPNFLQPC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|