C25H29ClFN5O4S2 — CID 118109227
5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[[(1S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 118109227) has the molecular formula C25H29ClFN5O4S2 and a molecular weight of 582.12 g/mol. Its IUPAC name is 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[[(1S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[[(1S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118109227 |
| Molecular Formula | C25H29ClFN5O4S2 |
| Molecular Weight | 582.12 g/mol |
| Exact Mass | 581.13 |
| IUPAC Name | 5-chloro-N-[(2,4-dimethoxyphenyl)methyl]-2-fluoro-4-[[(1S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methylamino]-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | COc1ccc(CN(c2ncns2)S(=O)(=O)c2cc(Cl)c(NC[C@@H]3CCN4CCCC34)cc2F)c(OC)c1 |
| InChI | InChI=1S/C25H29ClFN5O4S2/c1-35-18-6-5-17(23(10-18)36-2)14-32(25-29-15-30-37-25)38(33,34)24-11-19(26)21(12-20(24)27)28-13-16-7-9-31-8-3-4-22(16)31/h5-6,10-12,15-16,22,28H,3-4,7-9,13-14H2,1-2H3/t16-,22?/m0/s1 |
| InChIKey | UETFRHAPUNFQBG-CISYCMJJSA-N |
| XLogP | 4.64 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.12 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |