C32H32F4N4O5S2 — CID 135284338
(4S)-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-[(2S,4R)-2-pyridin-2-yl-4-(trifluoromethyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 135284338) has the molecular formula C32H32F4N4O5S2 and a molecular weight of 692.76 g/mol. Its IUPAC name is (4S)-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-[(2S,4R)-2-pyridin-2-yl-4-(trifluoromethyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | (4S)-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-[(2S,4R)-2-pyridin-2-yl-4-(trifluoromethyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 135284338 |
| Molecular Formula | C32H32F4N4O5S2 |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.18 |
| IUPAC Name | (4S)-N-[(2,4-dimethoxyphenyl)methyl]-6-fluoro-4-[(2S,4R)-2-pyridin-2-yl-4-(trifluoromethyl)piperidin-1-yl]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | COc1ccc(CN(c2nccs2)S(=O)(=O)c2cc3c(cc2F)[C@@H](N2CC[C@@H](C(F)(F)F)C[C@H]2c2ccccn2)CCO3)c(OC)c1 |
| InChI | InChI=1S/C32H32F4N4O5S2/c1-43-22-7-6-20(28(16-22)44-2)19-40(31-38-11-14-46-31)47(41,42)30-18-29-23(17-24(30)33)26(9-13-45-29)39-12-8-21(32(34,35)36)15-27(39)25-5-3-4-10-37-25/h3-7,10-11,14,16-18,21,26-27H,8-9,12-13,15,19H2,1-2H3/t21-,26+,27+/m1/s1 |
| InChIKey | DBPSSPLTAXZKFS-AIGMYPEUSA-N |
| XLogP | 6.93 |
| TPSA | 94.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |