C23H29NO3S — CID 135288362
1-[5-(4-cyclohexylsulfonylphenyl)-1,3-dimethyl-4-prop-2-enylpyrrol-2-yl]ethanone (PubChem CID 135288362) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[5-(4-cyclohexylsulfonylphenyl)-1,3-dimethyl-4-prop-2-enylpyrrol-2-yl]ethanone.
| Compound Name | 1-[5-(4-cyclohexylsulfonylphenyl)-1,3-dimethyl-4-prop-2-enylpyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 135288362 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-[5-(4-cyclohexylsulfonylphenyl)-1,3-dimethyl-4-prop-2-enylpyrrol-2-yl]ethanone |
| SMILES | C=CCc1c(C)c(C(C)=O)n(C)c1-c1ccc(S(=O)(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29NO3S/c1-5-9-21-16(2)22(17(3)25)24(4)23(21)18-12-14-20(15-13-18)28(26,27)19-10-7-6-8-11-19/h5,12-15,19H,1,6-11H2,2-4H3 |
| InChIKey | CALULPYAMUSYOH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|