C25H29N3O5S — CID 50824157
N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-(4-methylphenyl)acetamide (PubChem CID 50824157) has the molecular formula C25H29N3O5S and a molecular weight of 483.59 g/mol. Its IUPAC name is N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-(4-methylphenyl)acetamide.
| Compound Name | N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 50824157 |
| Molecular Formula | C25H29N3O5S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | N-(7-cyclohexylsulfonyl-1,4-dimethyl-2,3-dioxoquinoxalin-6-yl)-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2cc3c(cc2S(=O)(=O)C2CCCCC2)n(C)c(=O)c(=O)n3C)cc1 |
| InChI | InChI=1S/C25H29N3O5S/c1-16-9-11-17(12-10-16)13-23(29)26-19-14-20-21(28(3)25(31)24(30)27(20)2)15-22(19)34(32,33)18-7-5-4-6-8-18/h9-12,14-15,18H,4-8,13H2,1-3H3,(H,26,29) |
| InChIKey | NPCSLXMLWMVEBB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|